| |
Record |
Links |
|
Author |
Jamoul, J.; Radhakrishnan, S.; Houlleberghs, M.; Chandran, C.V.; Vits, A.; Weckx, P.; Smet, S.; Arenas Esteban, D.; Bals, S.; Martens, J.A.; Breynaert, E. |
|
| |
Title |
Synthesis and advanced NMR characterization of ordered 3D reticular materials with polysilicate nodes and hydrophobic organosilicone linkers |
Type |
A1 Journal article |
| |
Year  |
2025 |
Publication |
Molecules: a journal of synthetic chemistry and natural product chemistry |
Abbreviated Journal |
|
|
| |
Volume |
30 |
Issue |
2 |
Pages |
228-14 |
|
| |
Keywords |
A1 Journal article; Electron microscopy for materials research (EMAT) |
|
| |
Abstract |
This work describes the synthesis of ordered 3D siloxane-silsesquioxane reticular materials with silicate D4R cubes (Si8O208-), harvested from a sacrificial tetrabutylammonium cyclosilicate hydrate (TBA-CySH) precursor, interlinked with octyl and dicyclopentyl (Cp-2) hydrocarbon functionalities in a one-step synthesis with organodichlorosilanes. Advanced solid-state NMR spectroscopy allowed us to unravel the molecular order of the nodes and their interconnection by the silicone linkers. In the case of octyl-methyl silicone linkers, changing the silane-to-silicate ratio in the synthesis allowed for tuning the length of the linker between the nodes. With dicyclopentyl linkers, the addition of dimethyldichlorosilane was essential to enable the formation of a reticular network. The resulting materials contained mixed, dimeric silicone linkers, i.e., Si-8-O-Si(Me-2)-O-Si(Cp-2)-O-Si-8. |
|
| |
Address |
|
|
| |
Corporate Author |
|
Thesis |
|
|
| |
Publisher |
|
Place of Publication |
|
Editor |
|
|
| |
Language |
|
Wos |
WOS:001405882900001 |
Publication Date |
2025-01-08 |
|
| |
Series Editor |
|
Series Title |
|
Abbreviated Series Title |
|
|
| |
Series Volume |
|
Series Issue |
|
Edition |
|
|
| |
ISSN |
1420-3049 |
ISBN |
|
Additional Links |
UA library record; WoS full record |
|
| |
Impact Factor |
|
Times cited |
|
Open Access |
|
|
| |
Notes |
|
Approved |
no |
|
| |
Call Number |
UA @ admin @ c:irua:211797 |
Serial |
9465 |
|
| Permanent link to this record |
